C14H19F2NO4 — CID 139300931
2-[(1R,2R,3S,6S,8R)-7,7-difluoro-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]butanoic acid (PubChem CID 139300931) has the molecular formula C14H19F2NO4 and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-[(1R,2R,3S,6S,8R)-7,7-difluoro-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]butanoic acid.
| Compound Name | 2-[(1R,2R,3S,6S,8R)-7,7-difluoro-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]butanoic acid |
|---|---|
| PubChem CID | 139300931 |
| Molecular Formula | C14H19F2NO4 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-[(1R,2R,3S,6S,8R)-7,7-difluoro-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]butanoic acid |
| SMILES | CCC(C(=O)O)[C@]1(C[N+](=O)[O-])[C@@H]2C[C@@H]3CC[C@H]1[C@H]2C3(F)F |
| InChI | InChI=1S/C14H19F2NO4/c1-2-8(12(18)19)13(6-17(20)21)9-4-3-7-5-10(13)11(9)14(7,15)16/h7-11H,2-6H2,1H3,(H,18,19)/t7-,8?,9-,10+,11+,13-/m0/s1 |
| InChIKey | WHLCOLRAFJHTHM-ZGTAWKPRSA-N |
| XLogP | 2.67 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|