C15H17NO8 — CID 139301347
[4-(prop-2-enoylamino)phenyl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate (PubChem CID 139301347) has the molecular formula C15H17NO8 and a molecular weight of 339.30 g/mol. Its IUPAC name is [4-(prop-2-enoylamino)phenyl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
| Compound Name | [4-(prop-2-enoylamino)phenyl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 139301347 |
| Molecular Formula | C15H17NO8 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [4-(prop-2-enoylamino)phenyl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | C=CC(=O)Nc1ccc(OC(=O)[C@H]2O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C15H17NO8/c1-2-9(17)16-7-3-5-8(6-4-7)23-15(22)13-11(19)10(18)12(20)14(21)24-13/h2-6,10-14,18-21H,1H2,(H,16,17)/t10-,11-,12+,13-,14+/m0/s1 |
| InChIKey | UAEQUSUITFPLSH-PDWCTOEPSA-N |
| XLogP | -1.48 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|