C14H24N2O8 — CID 139301563
bis(4,4-dimethyl-1,3-oxazolidin-2-yl) 2,3-dihydroxybutanedioate (PubChem CID 139301563) has the molecular formula C14H24N2O8 and a molecular weight of 348.35 g/mol. Its IUPAC name is bis(4,4-dimethyl-1,3-oxazolidin-2-yl) 2,3-dihydroxybutanedioate.
| Compound Name | bis(4,4-dimethyl-1,3-oxazolidin-2-yl) 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 139301563 |
| Molecular Formula | C14H24N2O8 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | bis(4,4-dimethyl-1,3-oxazolidin-2-yl) 2,3-dihydroxybutanedioate |
| SMILES | CC1(C)COC(OC(=O)C(O)C(O)C(=O)OC2NC(C)(C)CO2)N1 |
| InChI | InChI=1S/C14H24N2O8/c1-13(2)5-21-11(15-13)23-9(19)7(17)8(18)10(20)24-12-16-14(3,4)6-22-12/h7-8,11-12,15-18H,5-6H2,1-4H3 |
| InChIKey | OOEFARJJMPGXOA-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |