C13H22O — CID 139301707
5-(2-methylpropoxy)-5-propan-2-ylcyclohexa-1,3-diene (PubChem CID 139301707) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 5-(2-methylpropoxy)-5-propan-2-ylcyclohexa-1,3-diene.
| Compound Name | 5-(2-methylpropoxy)-5-propan-2-ylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 139301707 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 5-(2-methylpropoxy)-5-propan-2-ylcyclohexa-1,3-diene |
| SMILES | CC(C)COC1(C(C)C)C=CC=CC1 |
| InChI | InChI=1S/C13H22O/c1-11(2)10-14-13(12(3)4)8-6-5-7-9-13/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | GMLUCBDPGSIWFK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |