C23H24F3N7O4 — CID 139301790
[(3S,4S)-1-(7-methoxy-3-nitroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 139301790) has the molecular formula C23H24F3N7O4 and a molecular weight of 519.48 g/mol. Its IUPAC name is [(3S,4S)-1-(7-methoxy-3-nitroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | [(3S,4S)-1-(7-methoxy-3-nitroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 139301790 |
| Molecular Formula | C23H24F3N7O4 |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | [(3S,4S)-1-(7-methoxy-3-nitroquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | COc1ccc2c(N3CC[C@H](C(=O)N4CCn5c(nnc5C(F)(F)F)C4)[C@H](C)C3)c([N+](=O)[O-])cnc2c1 |
| InChI | InChI=1S/C23H24F3N7O4/c1-13-11-30(20-16-4-3-14(37-2)9-17(16)27-10-18(20)33(35)36)6-5-15(13)21(34)31-7-8-32-19(12-31)28-29-22(32)23(24,25)26/h3-4,9-10,13,15H,5-8,11-12H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | SYUPAGXNKDGSRQ-HIFRSBDPSA-N |
| XLogP | 3.27 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|