C23H21ClF6N6O2 — CID 139301801
[(3S,4S)-1-[3-chloro-1-oxido-7-(trifluoromethyl)quinolin-1-ium-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 139301801) has the molecular formula C23H21ClF6N6O2 and a molecular weight of 562.90 g/mol. Its IUPAC name is [(3S,4S)-1-[3-chloro-1-oxido-7-(trifluoromethyl)quinolin-1-ium-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | [(3S,4S)-1-[3-chloro-1-oxido-7-(trifluoromethyl)quinolin-1-ium-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 139301801 |
| Molecular Formula | C23H21ClF6N6O2 |
| Molecular Weight | 562.90 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | [(3S,4S)-1-[3-chloro-1-oxido-7-(trifluoromethyl)quinolin-1-ium-4-yl]-3-methylpiperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | C[C@@H]1CN(c2c(Cl)c[n+]([O-])c3cc(C(F)(F)F)ccc23)CC[C@@H]1C(=O)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C23H21ClF6N6O2/c1-12-9-33(19-15-3-2-13(22(25,26)27)8-17(15)36(38)10-16(19)24)5-4-14(12)20(37)34-6-7-35-18(11-34)31-32-21(35)23(28,29)30/h2-3,8,10,12,14H,4-7,9,11H2,1H3/t12-,14+/m1/s1 |
| InChIKey | AUNGEZBADPPSJI-OCCSQVGLSA-N |
| XLogP | 4.26 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.90 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|