About (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine
(2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine (PubChem CID 139301974) has the molecular formula C15H30N2O3S
and a molecular weight of 318.48 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine.
Molecular Properties
| Compound Name | (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine |
| PubChem CID | 139301974 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine |
| SMILES | CC(C)N1[C@H](C)CN(S(=O)(=O)CC2CCOCC2)C[C@@H]1C |
| InChI | InChI=1S/C15H30N2O3S/c1-12(2)17-13(3)9-16(10-14(17)4)21(18,19)11-15-5-7-20-8-6-15/h12-15H,5-11H2,1-4H3/t13-,14+ |
| InChIKey | WINRNHMWHQYHAP-OKILXGFUSA-N |
| XLogP | 1.55 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine?
The IUPAC name of (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine (CID 139301974) is (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine.
What is the SMILES notation for (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine?
The canonical SMILES for (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine is CC(C)N1[C@H](C)CN(S(=O)(=O)CC2CCOCC2)C[C@@H]1C.
What is the InChIKey of (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine?
The InChIKey is WINRNHMWHQYHAP-OKILXGFUSA-N. The full InChI is InChI=1S/C15H30N2O3S/c1-12(2)17-13(3)9-16(10-14(17)4)21(18,19)11-15-5-7-20-8-6-15/h12-15H,5-11H2,1-4H3/t13-,14+.
What are the key properties of (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine?
(2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine has a molecular weight of 318.48 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-2,6-dimethyl-4-(oxan-4-ylmethylsulfonyl)-1-propan-2-ylpiperazine is sourced from PubChem (CID 139301974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).