C22H21F4N3O2 — CID 139301979
3-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,1-difluoro-2-oxoethyl]-4-fluoro-N-(4-fluoro-3-methylphenyl)benzamide (PubChem CID 139301979) has the molecular formula C22H21F4N3O2 and a molecular weight of 435.42 g/mol. Its IUPAC name is 3-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,1-difluoro-2-oxoethyl]-4-fluoro-N-(4-fluoro-3-methylphenyl)benzamide.
| Compound Name | 3-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,1-difluoro-2-oxoethyl]-4-fluoro-N-(4-fluoro-3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 139301979 |
| Molecular Formula | C22H21F4N3O2 |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 3-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,1-difluoro-2-oxoethyl]-4-fluoro-N-(4-fluoro-3-methylphenyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(F)c(C(F)(F)C(=O)N3CC4CNCC4C3)c2)ccc1F |
| InChI | InChI=1S/C22H21F4N3O2/c1-12-6-16(3-5-18(12)23)28-20(30)13-2-4-19(24)17(7-13)22(25,26)21(31)29-10-14-8-27-9-15(14)11-29/h2-7,14-15,27H,8-11H2,1H3,(H,28,30) |
| InChIKey | IBLLMWUKPCTGJE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |