About 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole
4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole (PubChem CID 139302679) has the molecular formula C13H13F2N3S
and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole.
Molecular Properties
| Compound Name | 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole |
| PubChem CID | 139302679 |
| Molecular Formula | C13H13F2N3S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole |
| SMILES | Fc1ccc([C@H]2CCN(Cc3csnn3)C2)cc1F |
| InChI | InChI=1S/C13H13F2N3S/c14-12-2-1-9(5-13(12)15)10-3-4-18(6-10)7-11-8-19-17-16-11/h1-2,5,8,10H,3-4,6-7H2/t10-/m0/s1 |
| InChIKey | JOJFVYAVFLZPEF-JTQLQIEISA-N |
| XLogP | 2.81 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole?
The IUPAC name of 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole (CID 139302679) is 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole.
What is the SMILES notation for 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole?
The canonical SMILES for 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole is Fc1ccc([C@H]2CCN(Cc3csnn3)C2)cc1F.
What is the InChIKey of 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole?
The InChIKey is JOJFVYAVFLZPEF-JTQLQIEISA-N. The full InChI is InChI=1S/C13H13F2N3S/c14-12-2-1-9(5-13(12)15)10-3-4-18(6-10)7-11-8-19-17-16-11/h1-2,5,8,10H,3-4,6-7H2/t10-/m0/s1.
What are the key properties of 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole?
4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole has a molecular weight of 281.33 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3R)-3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]thiadiazole is sourced from PubChem (CID 139302679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).