C16H18F4N4O3S — CID 139302843
ethyl 6-[(3,3,5,5-tetrafluoro-4-hydroxypiperidin-1-yl)methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 139302843) has the molecular formula C16H18F4N4O3S and a molecular weight of 422.40 g/mol. Its IUPAC name is ethyl 6-[(3,3,5,5-tetrafluoro-4-hydroxypiperidin-1-yl)methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-[(3,3,5,5-tetrafluoro-4-hydroxypiperidin-1-yl)methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 139302843 |
| Molecular Formula | C16H18F4N4O3S |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | ethyl 6-[(3,3,5,5-tetrafluoro-4-hydroxypiperidin-1-yl)methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CN2CC(F)(F)C(O)C(F)(F)C2)NC(c2nccs2)=NC1 |
| InChI | InChI=1S/C16H18F4N4O3S/c1-2-27-13(25)9-5-22-11(12-21-3-4-28-12)23-10(9)6-24-7-15(17,18)14(26)16(19,20)8-24/h3-4,14,26H,2,5-8H2,1H3,(H,22,23) |
| InChIKey | IPVNAOCYXQBOIR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |