About (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine
(E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine (PubChem CID 139302953) has the molecular formula C7H10N2S
and a molecular weight of 154.24 g/mol. Its IUPAC name is (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine |
| PubChem CID | 139302953 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine |
| SMILES | [H]/N=C(\C=C\C)C1=NCCS1 |
| InChI | InChI=1S/C7H10N2S/c1-2-3-6(8)7-9-4-5-10-7/h2-3,8H,4-5H2,1H3/b3-2+,8-6+ |
| InChIKey | HWUPKPWCSQZTEA-IQMDXYROSA-N |
| XLogP | 1.73 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine?
The IUPAC name of (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine (CID 139302953) is (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine.
What is the SMILES notation for (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine?
The canonical SMILES for (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine is [H]/N=C(\C=C\C)C1=NCCS1.
What is the InChIKey of (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine?
The InChIKey is HWUPKPWCSQZTEA-IQMDXYROSA-N. The full InChI is InChI=1S/C7H10N2S/c1-2-3-6(8)7-9-4-5-10-7/h2-3,8H,4-5H2,1H3/b3-2+,8-6+.
What are the key properties of (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine?
(E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine has a molecular weight of 154.24 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(4,5-dihydro-1,3-thiazol-2-yl)but-2-en-1-imine is sourced from PubChem (CID 139302953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).