C13H11Br2Cl2NO3 — CID 139303549
(5Z)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-2-(1,1-dichloroethyl)-1,3-oxazolidin-4-one (PubChem CID 139303549) has the molecular formula C13H11Br2Cl2NO3 and a molecular weight of 459.95 g/mol. Its IUPAC name is (5Z)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-2-(1,1-dichloroethyl)-1,3-oxazolidin-4-one.
| Compound Name | (5Z)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-2-(1,1-dichloroethyl)-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 139303549 |
| Molecular Formula | C13H11Br2Cl2NO3 |
| Molecular Weight | 459.95 g/mol |
| Exact Mass | 456.85 |
| IUPAC Name | (5Z)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-2-(1,1-dichloroethyl)-1,3-oxazolidin-4-one |
| SMILES | COc1c(Br)cc(/C=C2\OC(C(C)(Cl)Cl)NC2=O)cc1Br |
| InChI | InChI=1S/C13H11Br2Cl2NO3/c1-13(16,17)12-18-11(19)9(21-12)5-6-3-7(14)10(20-2)8(15)4-6/h3-5,12H,1-2H3,(H,18,19)/b9-5- |
| InChIKey | ZWLBCVFRSUKDJV-UITAMQMPSA-N |
| XLogP | 4.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.95 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|