C23H24N4O3S2 — CID 139303559
5-cyclopropyl-N-[(1S)-1-[4-(hydroxycarbamoyl)phenyl]ethyl]-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 139303559) has the molecular formula C23H24N4O3S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 5-cyclopropyl-N-[(1S)-1-[4-(hydroxycarbamoyl)phenyl]ethyl]-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-N-[(1S)-1-[4-(hydroxycarbamoyl)phenyl]ethyl]-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 139303559 |
| Molecular Formula | C23H24N4O3S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 5-cyclopropyl-N-[(1S)-1-[4-(hydroxycarbamoyl)phenyl]ethyl]-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | C[C@H](NC(=O)c1nc(-c2nc3c(s2)CCCC3)sc1C1CC1)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C23H24N4O3S2/c1-12(13-6-10-15(11-7-13)20(28)27-30)24-21(29)18-19(14-8-9-14)32-23(26-18)22-25-16-4-2-3-5-17(16)31-22/h6-7,10-12,14,30H,2-5,8-9H2,1H3,(H,24,29)(H,27,28)/t12-/m0/s1 |
| InChIKey | MIMRQUUGDOYHSE-LBPRGKRZSA-N |
| XLogP | 4.63 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|