C20H25N3O — CID 139303961
(2S)-N-(1-cyclobutyl-6-ethynylbenzimidazol-2-yl)-2,3,3-trimethylbutanamide (PubChem CID 139303961) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (2S)-N-(1-cyclobutyl-6-ethynylbenzimidazol-2-yl)-2,3,3-trimethylbutanamide.
| Compound Name | (2S)-N-(1-cyclobutyl-6-ethynylbenzimidazol-2-yl)-2,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 139303961 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (2S)-N-(1-cyclobutyl-6-ethynylbenzimidazol-2-yl)-2,3,3-trimethylbutanamide |
| SMILES | C#Cc1ccc2nc(NC(=O)[C@@H](C)C(C)(C)C)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C20H25N3O/c1-6-14-10-11-16-17(12-14)23(15-8-7-9-15)19(21-16)22-18(24)13(2)20(3,4)5/h1,10-13,15H,7-9H2,2-5H3,(H,21,22,24)/t13-/m1/s1 |
| InChIKey | LLJCKOMTLPYVJL-CYBMUJFWSA-N |
| XLogP | 4.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|