About 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine
5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine (PubChem CID 139304201) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine.
Molecular Properties
| Compound Name | 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine |
| PubChem CID | 139304201 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine |
| SMILES | C=CC1=C(/C=C\C)C=NCN=C1 |
| InChI | InChI=1S/C10H12N2/c1-3-5-10-7-12-8-11-6-9(10)4-2/h3-7H,2,8H2,1H3/b5-3- |
| InChIKey | CDUYNUJRCJZIPH-HYXAFXHYSA-N |
| XLogP | 2.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine?
The IUPAC name of 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine (CID 139304201) is 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine.
What is the SMILES notation for 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine?
The canonical SMILES for 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine is C=CC1=C(/C=C\C)C=NCN=C1.
What is the InChIKey of 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine?
The InChIKey is CDUYNUJRCJZIPH-HYXAFXHYSA-N. The full InChI is InChI=1S/C10H12N2/c1-3-5-10-7-12-8-11-6-9(10)4-2/h3-7H,2,8H2,1H3/b5-3-.
What are the key properties of 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine?
5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine has a molecular weight of 160.22 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-6-[(Z)-prop-1-enyl]-2H-1,3-diazepine is sourced from PubChem (CID 139304201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).