About methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate
methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate (PubChem CID 139304621) has the molecular formula C7H11F2NO2
and a molecular weight of 179.17 g/mol. Its IUPAC name is methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate |
| PubChem CID | 139304621 |
| Molecular Formula | C7H11F2NO2 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate |
| SMILES | COC(=O)NC1(CC(F)F)CC1 |
| InChI | InChI=1S/C7H11F2NO2/c1-12-6(11)10-7(2-3-7)4-5(8)9/h5H,2-4H2,1H3,(H,10,11) |
| InChIKey | OZDOQQXUNFYLRR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate?
The IUPAC name of methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate (CID 139304621) is methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate.
What is the SMILES notation for methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate?
The canonical SMILES for methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate is COC(=O)NC1(CC(F)F)CC1.
What is the InChIKey of methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate?
The InChIKey is OZDOQQXUNFYLRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO2/c1-12-6(11)10-7(2-3-7)4-5(8)9/h5H,2-4H2,1H3,(H,10,11).
What are the key properties of methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate?
methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate has a molecular weight of 179.17 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[1-(2,2-difluoroethyl)cyclopropyl]carbamate is sourced from PubChem (CID 139304621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).