C16H19NO4 — CID 139304781
3-[(1S)-1-[(2R,4aS)-4a,8-dimethyl-7-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]-1,4,2-dioxazol-5-one (PubChem CID 139304781) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-[(1S)-1-[(2R,4aS)-4a,8-dimethyl-7-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]-1,4,2-dioxazol-5-one.
| Compound Name | 3-[(1S)-1-[(2R,4aS)-4a,8-dimethyl-7-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]-1,4,2-dioxazol-5-one |
|---|---|
| PubChem CID | 139304781 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-[(1S)-1-[(2R,4aS)-4a,8-dimethyl-7-oxo-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]-1,4,2-dioxazol-5-one |
| SMILES | CC1=C2C[C@H]([C@H](C)c3noc(=O)o3)CC[C@@]2(C)C=CC1=O |
| InChI | InChI=1S/C16H19NO4/c1-9(14-17-21-15(19)20-14)11-4-6-16(3)7-5-13(18)10(2)12(16)8-11/h5,7,9,11H,4,6,8H2,1-3H3/t9-,11+,16-/m0/s1 |
| InChIKey | ASJIEZGZACXYEP-ZXLZKYRFSA-N |
| XLogP | 2.99 |
| TPSA | 73.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |