About 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine
2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine (PubChem CID 139305711) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine.
Molecular Properties
| Compound Name | 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine |
| PubChem CID | 139305711 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine |
| SMILES | C=C/C=C(\C)N/C(N)=N/C(=C)C=C |
| InChI | InChI=1S/C10H15N3/c1-5-7-9(4)13-10(11)12-8(3)6-2/h5-7H,1-3H2,4H3,(H3,11,12,13)/b9-7+ |
| InChIKey | MOCUCQXHDQBGAE-VQHVLOKHSA-N |
| XLogP | 1.68 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine?
The IUPAC name of 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine (CID 139305711) is 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine.
What is the SMILES notation for 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine?
The canonical SMILES for 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine is C=C/C=C(\C)N/C(N)=N/C(=C)C=C.
What is the InChIKey of 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine?
The InChIKey is MOCUCQXHDQBGAE-VQHVLOKHSA-N. The full InChI is InChI=1S/C10H15N3/c1-5-7-9(4)13-10(11)12-8(3)6-2/h5-7H,1-3H2,4H3,(H3,11,12,13)/b9-7+.
What are the key properties of 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine?
2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine has a molecular weight of 177.25 g/mol, XLogP of 1.68, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-buta-1,3-dien-2-yl-1-[(2E)-penta-2,4-dien-2-yl]guanidine is sourced from PubChem (CID 139305711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).