C36H54P4 — CID 139306011
(2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-3-[(2R,5R)-1-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholan-3-yl]-2,5-dimethylphospholane (PubChem CID 139306011) has the molecular formula C36H54P4 and a molecular weight of 610.72 g/mol. Its IUPAC name is (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-3-[(2R,5R)-1-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholan-3-yl]-2,5-dimethylphospholane.
| Compound Name | (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-3-[(2R,5R)-1-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholan-3-yl]-2,5-dimethylphospholane |
|---|---|
| PubChem CID | 139306011 |
| Molecular Formula | C36H54P4 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.32 |
| IUPAC Name | (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-3-[(2R,5R)-1-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholan-3-yl]-2,5-dimethylphospholane |
| SMILES | C[C@@H]1CC[C@@H](C)P1c1ccccc1P1[C@H](C)CC(C2C[C@@H](C)P(c3ccccc3P3[C@@H](C)CC[C@@H]3C)[C@@H]2C)[C@H]1C |
| InChI | InChI=1S/C36H54P4/c1-23-17-18-24(2)37(23)33-13-9-11-15-35(33)39-27(5)21-31(29(39)7)32-22-28(6)40(30(32)8)36-16-12-10-14-34(36)38-25(3)19-20-26(38)4/h9-16,23-32H,17-22H2,1-8H3/t23-,24-,25+,26+,27-,28-,29-,30-,31?,32?,39?,40?/m1/s1 |
| InChIKey | WBNBFJSKLRFKEW-VNDFRZPRSA-N |
| XLogP | 9.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|