C20H21FINO3S — CID 139306012
[5-[1-(2-fluorophenyl)-5-iodo-2-oxopentyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] acetate (PubChem CID 139306012) has the molecular formula C20H21FINO3S and a molecular weight of 501.36 g/mol. Its IUPAC name is [5-[1-(2-fluorophenyl)-5-iodo-2-oxopentyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] acetate.
| Compound Name | [5-[1-(2-fluorophenyl)-5-iodo-2-oxopentyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] acetate |
|---|---|
| PubChem CID | 139306012 |
| Molecular Formula | C20H21FINO3S |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 501.03 |
| IUPAC Name | [5-[1-(2-fluorophenyl)-5-iodo-2-oxopentyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(s1)CCN(C(C(=O)CCCI)c1ccccc1F)C2 |
| InChI | InChI=1S/C20H21FINO3S/c1-13(24)26-19-11-14-12-23(10-8-18(14)27-19)20(17(25)7-4-9-22)15-5-2-3-6-16(15)21/h2-3,5-6,11,20H,4,7-10,12H2,1H3 |
| InChIKey | GHFVFQLRFXYTKP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|