About N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide
N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide (PubChem CID 139306233) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide.
Molecular Properties
| Compound Name | N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide |
| PubChem CID | 139306233 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide |
| SMILES | C=CC(=C)/N=C(\C)N/C(C)=C/N |
| InChI | InChI=1S/C9H15N3/c1-5-7(2)11-9(4)12-8(3)6-10/h5-6H,1-2,10H2,3-4H3,(H,11,12)/b8-6+ |
| InChIKey | UOHCQWXVKHPKGT-SOFGYWHQSA-N |
| XLogP | 1.51 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide?
The IUPAC name of N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide (CID 139306233) is N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide.
What is the SMILES notation for N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide?
The canonical SMILES for N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide is C=CC(=C)/N=C(\C)N/C(C)=C/N.
What is the InChIKey of N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide?
The InChIKey is UOHCQWXVKHPKGT-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H15N3/c1-5-7(2)11-9(4)12-8(3)6-10/h5-6H,1-2,10H2,3-4H3,(H,11,12)/b8-6+.
What are the key properties of N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide?
N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide has a molecular weight of 165.24 g/mol, XLogP of 1.51, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-aminoprop-1-en-2-yl]-N'-buta-1,3-dien-2-ylethanimidamide is sourced from PubChem (CID 139306233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).