C21H27N3O3S — CID 139306671
1-[5-(3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(oxan-3-yl)ethanone (PubChem CID 139306671) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 1-[5-(3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(oxan-3-yl)ethanone.
| Compound Name | 1-[5-(3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(oxan-3-yl)ethanone |
|---|---|
| PubChem CID | 139306671 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-[5-(3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(oxan-3-yl)ethanone |
| SMILES | O=C(CC1CCCOC1)N1CC2=C(CN(Sc3ccc4c(c3)NCCO4)C2)C1 |
| InChI | InChI=1S/C21H27N3O3S/c25-21(8-15-2-1-6-26-14-15)23-10-16-12-24(13-17(16)11-23)28-18-3-4-20-19(9-18)22-5-7-27-20/h3-4,9,15,22H,1-2,5-8,10-14H2 |
| InChIKey | UQOJLNRMUJGEPL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|