C54H30F6N4O — CID 139306916
4-[4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]-9-spiro[fluorene-9,9'-xanthene]-2-ylcarbazole (PubChem CID 139306916) has the molecular formula C54H30F6N4O and a molecular weight of 864.85 g/mol. Its IUPAC name is 4-[4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]-9-spiro[fluorene-9,9'-xanthene]-2-ylcarbazole.
| Compound Name | 4-[4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]-9-spiro[fluorene-9,9'-xanthene]-2-ylcarbazole |
|---|---|
| PubChem CID | 139306916 |
| Molecular Formula | C54H30F6N4O |
| Molecular Weight | 864.85 g/mol |
| Exact Mass | 864.23 |
| IUPAC Name | 4-[4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]-9-spiro[fluorene-9,9'-xanthene]-2-ylcarbazole |
| SMILES | FC(F)(F)c1ccc(-c2nc(-c3ccc(C(F)(F)F)cc3)nc(-c3cccc4c3c3ccccc3n4-c3ccc4c(c3)C3(c5ccccc5Oc5ccccc53)c3ccccc3-4)n2)cc1 |
| InChI | InChI=1S/C54H30F6N4O/c55-53(56,57)33-24-20-31(21-25-33)49-61-50(32-22-26-34(27-23-32)54(58,59)60)63-51(62-49)39-12-9-17-45-48(39)38-11-2-6-16-44(38)64(45)35-28-29-37-36-10-1-3-13-40(36)52(43(37)30-35)41-14-4-7-18-46(41)65-47-19-8-5-15-42(47)52/h1-30H |
| InChIKey | KDVMQQXNJPNOOO-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.85 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |