About 5-ethynylcyclohexa-2,4-dien-1-amine
5-ethynylcyclohexa-2,4-dien-1-amine (PubChem CID 139307013) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 5-ethynylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 5-ethynylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 139307013 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 5-ethynylcyclohexa-2,4-dien-1-amine |
| SMILES | C#CC1=CC=CC(N)C1 |
| InChI | InChI=1S/C8H9N/c1-2-7-4-3-5-8(9)6-7/h1,3-5,8H,6,9H2 |
| InChIKey | MCSXCCHBVRVTGM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 5-ethynylcyclohexa-2,4-dien-1-amine (CID 139307013) is 5-ethynylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 5-ethynylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 5-ethynylcyclohexa-2,4-dien-1-amine is C#CC1=CC=CC(N)C1.
What is the InChIKey of 5-ethynylcyclohexa-2,4-dien-1-amine?
The InChIKey is MCSXCCHBVRVTGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-2-7-4-3-5-8(9)6-7/h1,3-5,8H,6,9H2.
What are the key properties of 5-ethynylcyclohexa-2,4-dien-1-amine?
5-ethynylcyclohexa-2,4-dien-1-amine has a molecular weight of 119.17 g/mol, XLogP of 0.83, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 139307013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).