C25H29N3O3S — CID 139307090
(2S)-1-[5-[(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)sulfanyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-3-hydroxy-2-phenylpropan-1-one (PubChem CID 139307090) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is (2S)-1-[5-[(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)sulfanyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-3-hydroxy-2-phenylpropan-1-one.
| Compound Name | (2S)-1-[5-[(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)sulfanyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-3-hydroxy-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 139307090 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (2S)-1-[5-[(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)sulfanyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-3-hydroxy-2-phenylpropan-1-one |
| SMILES | CC1(C)CNc2cc(SN3CC4=C(C3)CN(C(=O)[C@H](CO)c3ccccc3)C4)ccc2O1 |
| InChI | InChI=1S/C25H29N3O3S/c1-25(2)16-26-22-10-20(8-9-23(22)31-25)32-28-13-18-11-27(12-19(18)14-28)24(30)21(15-29)17-6-4-3-5-7-17/h3-10,21,26,29H,11-16H2,1-2H3/t21-/m1/s1 |
| InChIKey | GONRVJSPBNUMQS-OAQYLSRUSA-N |
| XLogP | 3.51 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|