C22H25N7O3S2 — CID 139307684
4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethyl]pyrimidin-2-amine (PubChem CID 139307684) has the molecular formula C22H25N7O3S2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethyl]pyrimidin-2-amine.
| Compound Name | 4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 139307684 |
| Molecular Formula | C22H25N7O3S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(6-methyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethyl]pyrimidin-2-amine |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCN3CCCN(C)S3(=O)=O)n2)c1 |
| InChI | InChI=1S/C22H25N7O3S2/c1-27-10-4-11-28(34(27,30)31)12-9-24-21-23-8-7-18(25-21)20-19(26-22-29(20)13-14-33-22)16-5-3-6-17(15-16)32-2/h3,5-8,13-15H,4,9-12H2,1-2H3,(H,23,24,25) |
| InChIKey | GAXNSRXKNPVDFN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |