C23H25ClN4O — CID 139307708
[(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chloro-1-methylpyrrolo[2,3-b]pyridin-5-yl)methanone (PubChem CID 139307708) has the molecular formula C23H25ClN4O and a molecular weight of 408.93 g/mol. Its IUPAC name is [(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chloro-1-methylpyrrolo[2,3-b]pyridin-5-yl)methanone.
| Compound Name | [(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chloro-1-methylpyrrolo[2,3-b]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 139307708 |
| Molecular Formula | C23H25ClN4O |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chloro-1-methylpyrrolo[2,3-b]pyridin-5-yl)methanone |
| SMILES | Cn1ccc2c(Cl)c(C(=O)N3CCN4C[C@@H](c5ccccc5)CC[C@@H]4C3)cnc21 |
| InChI | InChI=1S/C23H25ClN4O/c1-26-10-9-19-21(24)20(13-25-22(19)26)23(29)28-12-11-27-14-17(7-8-18(27)15-28)16-5-3-2-4-6-16/h2-6,9-10,13,17-18H,7-8,11-12,14-15H2,1H3/t17-,18+/m0/s1 |
| InChIKey | NRLXRFMFMWERBY-ZWKOTPCHSA-N |
| XLogP | 3.93 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |