C21H23N7O3S2 — CID 139307731
N-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine (PubChem CID 139307731) has the molecular formula C21H23N7O3S2 and a molecular weight of 485.60 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | N-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 139307731 |
| Molecular Formula | C21H23N7O3S2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCN3CCCNS3(=O)=O)n2)c1 |
| InChI | InChI=1S/C21H23N7O3S2/c1-31-16-5-2-4-15(14-16)18-19(28-12-13-32-21(28)26-18)17-6-8-22-20(25-17)23-9-11-27-10-3-7-24-33(27,29)30/h2,4-6,8,12-14,24H,3,7,9-11H2,1H3,(H,22,23,25) |
| InChIKey | HMYRHTUJSGBXRF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |