About (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol
(4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol (PubChem CID 139307737) has the molecular formula C10H14O2S
and a molecular weight of 198.29 g/mol. Its IUPAC name is (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol |
| PubChem CID | 139307737 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol |
| SMILES | COC1=C/C(=C(/C)SC)CC=C1O |
| InChI | InChI=1S/C10H14O2S/c1-7(13-3)8-4-5-9(11)10(6-8)12-2/h5-6,11H,4H2,1-3H3/b8-7- |
| InChIKey | SIGGEUWNRIVTPT-FPLPWBNLSA-N |
| XLogP | 3.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol?
The IUPAC name of (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol (CID 139307737) is (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol.
What is the SMILES notation for (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol?
The canonical SMILES for (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol is COC1=C/C(=C(/C)SC)CC=C1O.
What is the InChIKey of (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol?
The InChIKey is SIGGEUWNRIVTPT-FPLPWBNLSA-N. The full InChI is InChI=1S/C10H14O2S/c1-7(13-3)8-4-5-9(11)10(6-8)12-2/h5-6,11H,4H2,1-3H3/b8-7-.
What are the key properties of (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol?
(4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol has a molecular weight of 198.29 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-6-methoxy-4-(1-methylsulfanylethylidene)cyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 139307737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).