About (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide
(Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide (PubChem CID 139308369) has the molecular formula C6H11N5
and a molecular weight of 153.19 g/mol. Its IUPAC name is (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide |
| PubChem CID | 139308369 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide |
| SMILES | [H]/N=C/N=C(N)/C(=C/NC)N=C |
| InChI | InChI=1S/C6H11N5/c1-9-3-5(10-2)6(8)11-4-7/h3-4,9H,2H2,1H3,(H3,7,8,11)/b5-3- |
| InChIKey | CVHKODZPMOCPOA-HYXAFXHYSA-N |
| XLogP | -0.29 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide?
The IUPAC name of (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide (CID 139308369) is (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide.
What is the SMILES notation for (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide?
The canonical SMILES for (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide is [H]/N=C/N=C(N)/C(=C/NC)N=C.
What is the InChIKey of (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide?
The InChIKey is CVHKODZPMOCPOA-HYXAFXHYSA-N. The full InChI is InChI=1S/C6H11N5/c1-9-3-5(10-2)6(8)11-4-7/h3-4,9H,2H2,1H3,(H3,7,8,11)/b5-3-.
What are the key properties of (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide?
(Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide has a molecular weight of 153.19 g/mol, XLogP of -0.29, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-methanimidoyl-3-(methylamino)-2-(methylideneamino)prop-2-enimidamide is sourced from PubChem (CID 139308369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).