C18H31N3O2 — CID 139308404
1-[(1-tert-butyl-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-4-yl)oxy]-3,3-dimethylbutan-2-one (PubChem CID 139308404) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 1-[(1-tert-butyl-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-4-yl)oxy]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[(1-tert-butyl-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-4-yl)oxy]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 139308404 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 1-[(1-tert-butyl-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-4-yl)oxy]-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)COC1CCCCCc2c1nnn2C(C)(C)C |
| InChI | InChI=1S/C18H31N3O2/c1-17(2,3)15(22)12-23-14-11-9-7-8-10-13-16(14)19-20-21(13)18(4,5)6/h14H,7-12H2,1-6H3 |
| InChIKey | BSPYCIBRDXKPIE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |