C16H27NO2 — CID 139308579
(E,3E,5E)-7-methoxy-N-pentan-3-yloxy-3-[(Z)-prop-1-enyl]hepta-3,5-dien-2-imine (PubChem CID 139308579) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is (E,3E,5E)-7-methoxy-N-pentan-3-yloxy-3-[(Z)-prop-1-enyl]hepta-3,5-dien-2-imine.
| Compound Name | (E,3E,5E)-7-methoxy-N-pentan-3-yloxy-3-[(Z)-prop-1-enyl]hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 139308579 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | (E,3E,5E)-7-methoxy-N-pentan-3-yloxy-3-[(Z)-prop-1-enyl]hepta-3,5-dien-2-imine |
| SMILES | C/C=C\C(=C/C=C/COC)\C(C)=N\OC(CC)CC |
| InChI | InChI=1S/C16H27NO2/c1-6-11-15(12-9-10-13-18-5)14(4)17-19-16(7-2)8-3/h6,9-12,16H,7-8,13H2,1-5H3/b10-9+,11-6-,15-12+,17-14+ |
| InChIKey | SOBQUYUIINKAKG-IBVHBILNSA-N |
| XLogP | 4.27 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|