C21H20FN5OS — CID 139309291
4-[6-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[1,3]thiazolo[4,5-b]pyridin-2-yl]morpholine (PubChem CID 139309291) has the molecular formula C21H20FN5OS and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-[6-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[1,3]thiazolo[4,5-b]pyridin-2-yl]morpholine.
| Compound Name | 4-[6-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[1,3]thiazolo[4,5-b]pyridin-2-yl]morpholine |
|---|---|
| PubChem CID | 139309291 |
| Molecular Formula | C21H20FN5OS |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-[6-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[1,3]thiazolo[4,5-b]pyridin-2-yl]morpholine |
| SMILES | Fc1ccc2c3c([nH]c2c1)CCN(c1cnc2nc(N4CCOCC4)sc2c1)C3 |
| InChI | InChI=1S/C21H20FN5OS/c22-13-1-2-15-16-12-27(4-3-17(16)24-18(15)9-13)14-10-19-20(23-11-14)25-21(29-19)26-5-7-28-8-6-26/h1-2,9-11,24H,3-8,12H2 |
| InChIKey | ZKVZLKJUXRGVQO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|