C13H20O5 — CID 139309676
2-(3,3-dimethoxypropyl)-3-methylidene-3a,6,7,7a-tetrahydrofuro[3,2-b]pyran-5-one (PubChem CID 139309676) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-(3,3-dimethoxypropyl)-3-methylidene-3a,6,7,7a-tetrahydrofuro[3,2-b]pyran-5-one.
| Compound Name | 2-(3,3-dimethoxypropyl)-3-methylidene-3a,6,7,7a-tetrahydrofuro[3,2-b]pyran-5-one |
|---|---|
| PubChem CID | 139309676 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-(3,3-dimethoxypropyl)-3-methylidene-3a,6,7,7a-tetrahydrofuro[3,2-b]pyran-5-one |
| SMILES | C=C1C(CCC(OC)OC)OC2CCC(=O)OC12 |
| InChI | InChI=1S/C13H20O5/c1-8-9(5-7-12(15-2)16-3)17-10-4-6-11(14)18-13(8)10/h9-10,12-13H,1,4-7H2,2-3H3 |
| InChIKey | SKNKUROIMOEOHV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|