C36H38O9S — CID 139309846
[(2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(4-methyl-3-methylidene-2-oxopent-4-enyl)oxolan-2-yl]-2-benzoyloxypropyl] benzoate (PubChem CID 139309846) has the molecular formula C36H38O9S and a molecular weight of 646.76 g/mol. Its IUPAC name is [(2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(4-methyl-3-methylidene-2-oxopent-4-enyl)oxolan-2-yl]-2-benzoyloxypropyl] benzoate.
| Compound Name | [(2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(4-methyl-3-methylidene-2-oxopent-4-enyl)oxolan-2-yl]-2-benzoyloxypropyl] benzoate |
|---|---|
| PubChem CID | 139309846 |
| Molecular Formula | C36H38O9S |
| Molecular Weight | 646.76 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | [(2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(4-methyl-3-methylidene-2-oxopent-4-enyl)oxolan-2-yl]-2-benzoyloxypropyl] benzoate |
| SMILES | C=C(C)C(=C)C(=O)C[C@@H]1O[C@H](C[C@@H](COC(=O)c2ccccc2)OC(=O)c2ccccc2)[C@H](OC)C1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H38O9S/c1-24(2)25(3)31(37)21-32-30(23-46(40,41)29-18-12-7-13-19-29)34(42-4)33(45-32)20-28(44-36(39)27-16-10-6-11-17-27)22-43-35(38)26-14-8-5-9-15-26/h5-19,28,30,32-34H,1,3,20-23H2,2,4H3/t28-,30?,32-,33+,34+/m0/s1 |
| InChIKey | OSJOOLNYQJKOGY-WROPQPLVSA-N |
| XLogP | 5.42 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.76 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|