C15H12Br2N2O — CID 139310075
(5,6-dibromo-4-methyl-1H-benzimidazol-2-yl)-phenylmethanol (PubChem CID 139310075) has the molecular formula C15H12Br2N2O and a molecular weight of 396.08 g/mol. Its IUPAC name is (5,6-dibromo-4-methyl-1H-benzimidazol-2-yl)-phenylmethanol.
| Compound Name | (5,6-dibromo-4-methyl-1H-benzimidazol-2-yl)-phenylmethanol |
|---|---|
| PubChem CID | 139310075 |
| Molecular Formula | C15H12Br2N2O |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | (5,6-dibromo-4-methyl-1H-benzimidazol-2-yl)-phenylmethanol |
| SMILES | Cc1c(Br)c(Br)cc2[nH]c(C(O)c3ccccc3)nc12 |
| InChI | InChI=1S/C15H12Br2N2O/c1-8-12(17)10(16)7-11-13(8)19-15(18-11)14(20)9-5-3-2-4-6-9/h2-7,14,20H,1H3,(H,18,19) |
| InChIKey | UQUYGKHBJUMMOK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |