C24H13N3O2S — CID 139310201
12-(2-nitrophenyl)-9-thia-18,21-diazapentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(21),2(10),3,5,7,11,13,15,17,19-decaene (PubChem CID 139310201) has the molecular formula C24H13N3O2S and a molecular weight of 407.45 g/mol. Its IUPAC name is 12-(2-nitrophenyl)-9-thia-18,21-diazapentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(21),2(10),3,5,7,11,13,15,17,19-decaene.
| Compound Name | 12-(2-nitrophenyl)-9-thia-18,21-diazapentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(21),2(10),3,5,7,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 139310201 |
| Molecular Formula | C24H13N3O2S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 12-(2-nitrophenyl)-9-thia-18,21-diazapentacyclo[11.8.0.02,10.03,8.014,19]henicosa-1(21),2(10),3,5,7,11,13,15,17,19-decaene |
| SMILES | O=[N+]([O-])c1ccccc1-c1cc2sc3ccccc3c2c2ncc3ncccc3c12 |
| InChI | InChI=1S/C24H13N3O2S/c28-27(29)19-9-3-1-6-14(19)17-12-21-23(16-7-2-4-10-20(16)30-21)24-22(17)15-8-5-11-25-18(15)13-26-24/h1-13H |
| InChIKey | DZHVIGWPOBUNPA-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|