About 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate
2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate (PubChem CID 139310604) has the molecular formula C11H18INO5
and a molecular weight of 371.17 g/mol. Its IUPAC name is 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate |
| PubChem CID | 139310604 |
| Molecular Formula | C11H18INO5 |
| Molecular Weight | 371.17 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate |
| SMILES | CCC(C)(C)OC(=O)CC(O)CC(=O)NC(=O)I |
| InChI | InChI=1S/C11H18INO5/c1-4-11(2,3)18-9(16)6-7(14)5-8(15)13-10(12)17/h7,14H,4-6H2,1-3H3,(H,13,15,17) |
| InChIKey | FHJAXLWIJZFZHC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate?
The IUPAC name of 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate (CID 139310604) is 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate.
What is the SMILES notation for 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate?
The canonical SMILES for 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate is CCC(C)(C)OC(=O)CC(O)CC(=O)NC(=O)I.
What is the InChIKey of 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate?
The InChIKey is FHJAXLWIJZFZHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18INO5/c1-4-11(2,3)18-9(16)6-7(14)5-8(15)13-10(12)17/h7,14H,4-6H2,1-3H3,(H,13,15,17).
What are the key properties of 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate?
2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate has a molecular weight of 371.17 g/mol, XLogP of 1.53, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 5-(carboniodidoylamino)-3-hydroxy-5-oxopentanoate is sourced from PubChem (CID 139310604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).