C18H17N5OS — CID 139310855
5-[2-(2-phenylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 139310855) has the molecular formula C18H17N5OS and a molecular weight of 351.44 g/mol. Its IUPAC name is 5-[2-(2-phenylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[2-(2-phenylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 139310855 |
| Molecular Formula | C18H17N5OS |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 5-[2-(2-phenylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(C3=NN/C(=N/CCc4ccccc4)SC3)cc2[nH]1 |
| InChI | InChI=1S/C18H17N5OS/c24-17-20-14-7-6-13(10-15(14)21-17)16-11-25-18(23-22-16)19-9-8-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2,(H,19,23)(H2,20,21,24) |
| InChIKey | XTTWMJNRIDQJMR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|