C17H12N6OS — CID 139310859
3-[[5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]benzonitrile (PubChem CID 139310859) has the molecular formula C17H12N6OS and a molecular weight of 348.39 g/mol. Its IUPAC name is 3-[[5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]benzonitrile.
| Compound Name | 3-[[5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]benzonitrile |
|---|---|
| PubChem CID | 139310859 |
| Molecular Formula | C17H12N6OS |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 3-[[5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]benzonitrile |
| SMILES | N#Cc1cccc(/N=C2/NN=C(c3ccc4[nH]c(=O)[nH]c4c3)CS2)c1 |
| InChI | InChI=1S/C17H12N6OS/c18-8-10-2-1-3-12(6-10)19-17-23-22-15(9-25-17)11-4-5-13-14(7-11)21-16(24)20-13/h1-7H,9H2,(H,19,23)(H2,20,21,24) |
| InChIKey | DCNKXLRSDASBIK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|