C21H24N4O7S2 — CID 139311215
methyl [(3S,7S)-7-cyano-8a-methoxycarbonylsulfanyl-6-(6-methoxy-3-pyridinyl)-2,3,7-trimethyl-1,4-dioxo-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl]sulfanylformate (PubChem CID 139311215) has the molecular formula C21H24N4O7S2 and a molecular weight of 508.58 g/mol. Its IUPAC name is methyl [(3S,7S)-7-cyano-8a-methoxycarbonylsulfanyl-6-(6-methoxy-3-pyridinyl)-2,3,7-trimethyl-1,4-dioxo-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl]sulfanylformate.
| Compound Name | methyl [(3S,7S)-7-cyano-8a-methoxycarbonylsulfanyl-6-(6-methoxy-3-pyridinyl)-2,3,7-trimethyl-1,4-dioxo-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl]sulfanylformate |
|---|---|
| PubChem CID | 139311215 |
| Molecular Formula | C21H24N4O7S2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | methyl [(3S,7S)-7-cyano-8a-methoxycarbonylsulfanyl-6-(6-methoxy-3-pyridinyl)-2,3,7-trimethyl-1,4-dioxo-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl]sulfanylformate |
| SMILES | COC(=O)SC12C[C@](C)(C#N)C(c3ccc(OC)nc3)N1C(=O)[C@](C)(SC(=O)OC)N(C)C2=O |
| InChI | InChI=1S/C21H24N4O7S2/c1-19(11-22)10-21(34-18(29)32-6)16(27)24(3)20(2,33-17(28)31-5)15(26)25(21)14(19)12-7-8-13(30-4)23-9-12/h7-9,14H,10H2,1-6H3/t14?,19-,20+,21?/m1/s1 |
| InChIKey | QHQXQXNQWFYTHL-OQPAJQRQSA-N |
| XLogP | 2.78 |
| TPSA | 139.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|