C19H37NO4 — CID 139311404
(2R,3S,4R,5R,12R,14R)-2-ethyl-3,4-dihydroxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 139311404) has the molecular formula C19H37NO4 and a molecular weight of 343.51 g/mol. Its IUPAC name is (2R,3S,4R,5R,12R,14R)-2-ethyl-3,4-dihydroxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (2R,3S,4R,5R,12R,14R)-2-ethyl-3,4-dihydroxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 139311404 |
| Molecular Formula | C19H37NO4 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | (2R,3S,4R,5R,12R,14R)-2-ethyl-3,4-dihydroxy-5,6,12,14-tetramethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C[C@H](C)CCCCCN(C)[C@H](C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H37NO4/c1-6-16-18(22)17(21)15(4)20(5)11-9-7-8-10-13(2)12-14(3)19(23)24-16/h13-18,21-22H,6-12H2,1-5H3/t13-,14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | DSDXTFXFHJMGGV-TYENPDHQSA-N |
| XLogP | 2.59 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |