About 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid
7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid (PubChem CID 139312079) has the molecular formula C12H16FNO2
and a molecular weight of 225.26 g/mol. Its IUPAC name is 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid.
Molecular Properties
| Compound Name | 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid |
| PubChem CID | 139312079 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid |
| SMILES | CC1=C(N)C(C(=O)O)=CC=C(C(C)(C)F)C1 |
| InChI | InChI=1S/C12H16FNO2/c1-7-6-8(12(2,3)13)4-5-9(10(7)14)11(15)16/h4-5H,6,14H2,1-3H3,(H,15,16) |
| InChIKey | DAFTZMGSMCCWJH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid?
The IUPAC name of 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid (CID 139312079) is 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid.
What is the SMILES notation for 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid?
The canonical SMILES for 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid is CC1=C(N)C(C(=O)O)=CC=C(C(C)(C)F)C1.
What is the InChIKey of 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid?
The InChIKey is DAFTZMGSMCCWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO2/c1-7-6-8(12(2,3)13)4-5-9(10(7)14)11(15)16/h4-5H,6,14H2,1-3H3,(H,15,16).
What are the key properties of 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid?
7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid has a molecular weight of 225.26 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-4-(2-fluoropropan-2-yl)-6-methylcyclohepta-1,3,6-triene-1-carboxylic acid is sourced from PubChem (CID 139312079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).