C11H18O2 — CID 139312497
(6S,8S)-1-ethyl-6-methyltricyclo[3.2.1.03,8]octane-6,7-diol (PubChem CID 139312497) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (6S,8S)-1-ethyl-6-methyltricyclo[3.2.1.03,8]octane-6,7-diol.
| Compound Name | (6S,8S)-1-ethyl-6-methyltricyclo[3.2.1.03,8]octane-6,7-diol |
|---|---|
| PubChem CID | 139312497 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (6S,8S)-1-ethyl-6-methyltricyclo[3.2.1.03,8]octane-6,7-diol |
| SMILES | CCC12CC3CC([C@H]31)[C@](C)(O)C2O |
| InChI | InChI=1S/C11H18O2/c1-3-11-5-6-4-7(8(6)11)10(2,13)9(11)12/h6-9,12-13H,3-5H2,1-2H3/t6?,7?,8-,9?,10-,11?/m0/s1 |
| InChIKey | MYQOZPJVINMWDY-VLOBIDSLSA-N |
| XLogP | 1.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |