C68H55N7 — CID 139312540
3,6-ditert-butyl-1,8-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole (PubChem CID 139312540) has the molecular formula C68H55N7 and a molecular weight of 970.24 g/mol. Its IUPAC name is 3,6-ditert-butyl-1,8-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole.
| Compound Name | 3,6-ditert-butyl-1,8-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 139312540 |
| Molecular Formula | C68H55N7 |
| Molecular Weight | 970.24 g/mol |
| Exact Mass | 969.45 |
| IUPAC Name | 3,6-ditert-butyl-1,8-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole |
| SMILES | CC(C)(C)c1cc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)c2c(c1)c1cc(C(C)(C)C)cc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c1n2-c1ccccc1 |
| InChI | InChI=1S/C68H55N7/c1-67(2,3)52-40-55(44-32-36-50(37-33-44)65-71-61(46-22-12-7-13-23-46)69-62(72-65)47-24-14-8-15-25-47)59-57(42-52)58-43-53(68(4,5)6)41-56(60(58)75(59)54-30-20-11-21-31-54)45-34-38-51(39-35-45)66-73-63(48-26-16-9-17-27-48)70-64(74-66)49-28-18-10-19-29-49/h7-43H,1-6H3 |
| InChIKey | OKDHQPIVRAGOFR-UHFFFAOYSA-N |
| XLogP | 17.08 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.24 |
| LogP ≤ 5 | 17.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |