C48H52N2O6 — CID 139312829
methyl 4-[(8aS)-2-[3-[(8aS)-6-(4-methoxycarbonylphenyl)-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinoline-2-carbonyl]benzoyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoate (PubChem CID 139312829) has the molecular formula C48H52N2O6 and a molecular weight of 752.95 g/mol. Its IUPAC name is methyl 4-[(8aS)-2-[3-[(8aS)-6-(4-methoxycarbonylphenyl)-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinoline-2-carbonyl]benzoyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoate.
| Compound Name | methyl 4-[(8aS)-2-[3-[(8aS)-6-(4-methoxycarbonylphenyl)-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinoline-2-carbonyl]benzoyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoate |
|---|---|
| PubChem CID | 139312829 |
| Molecular Formula | C48H52N2O6 |
| Molecular Weight | 752.95 g/mol |
| Exact Mass | 752.38 |
| IUPAC Name | methyl 4-[(8aS)-2-[3-[(8aS)-6-(4-methoxycarbonylphenyl)-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinoline-2-carbonyl]benzoyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2=CC[C@]3(C)CN(C(=O)c4cccc(C(=O)N5CC=C6C(C)(C)C(c7ccc(C(=O)OC)cc7)=CC[C@]6(C)C5)c4)CC=C3C2(C)C)cc1 |
| InChI | InChI=1S/C48H52N2O6/c1-45(2)37(31-12-16-33(17-13-31)43(53)55-7)20-24-47(5)29-49(26-22-39(45)47)41(51)35-10-9-11-36(28-35)42(52)50-27-23-40-46(3,4)38(21-25-48(40,6)30-50)32-14-18-34(19-15-32)44(54)56-8/h9-23,28H,24-27,29-30H2,1-8H3/t47-,48-/m1/s1 |
| InChIKey | AHRBEVBJXRDHRV-URZIEALYSA-N |
| XLogP | 9.06 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.95 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|