C26H32N2O4 — CID 139312893
4-[(8aS)-2-[(2S,3R)-1,2-dimethyl-5-oxopyrrolidine-3-carbonyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid (PubChem CID 139312893) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 4-[(8aS)-2-[(2S,3R)-1,2-dimethyl-5-oxopyrrolidine-3-carbonyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid.
| Compound Name | 4-[(8aS)-2-[(2S,3R)-1,2-dimethyl-5-oxopyrrolidine-3-carbonyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid |
|---|---|
| PubChem CID | 139312893 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 4-[(8aS)-2-[(2S,3R)-1,2-dimethyl-5-oxopyrrolidine-3-carbonyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid |
| SMILES | C[C@H]1[C@H](C(=O)N2CC=C3C(C)(C)C(c4ccc(C(=O)O)cc4)=CC[C@]3(C)C2)CC(=O)N1C |
| InChI | InChI=1S/C26H32N2O4/c1-16-19(14-22(29)27(16)5)23(30)28-13-11-21-25(2,3)20(10-12-26(21,4)15-28)17-6-8-18(9-7-17)24(31)32/h6-11,16,19H,12-15H2,1-5H3,(H,31,32)/t16-,19+,26+/m0/s1 |
| InChIKey | UNURGZMCXZTCCO-KGVVXCLESA-N |
| XLogP | 3.84 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|