C25H24F9N3O5S — CID 139313416
2,2,2-trifluoro-N-[[(2S)-4-(5-methoxy-2-pyridinyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]methyl]ethanesulfonamide (PubChem CID 139313416) has the molecular formula C25H24F9N3O5S and a molecular weight of 649.53 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[(2S)-4-(5-methoxy-2-pyridinyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]methyl]ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-[[(2S)-4-(5-methoxy-2-pyridinyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 139313416 |
| Molecular Formula | C25H24F9N3O5S |
| Molecular Weight | 649.53 g/mol |
| Exact Mass | 649.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[[(2S)-4-(5-methoxy-2-pyridinyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]methyl]ethanesulfonamide |
| SMILES | COc1ccc(C2=C(CNS(=O)(=O)CC(F)(F)F)C(=O)N[C@@](c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)C2)nc1 |
| InChI | InChI=1S/C25H24F9N3O5S/c1-41-17-7-8-20(35-12-17)18-11-22(25(32,33)34,15-3-5-16(6-4-15)42-10-2-9-23(26,27)28)37-21(38)19(18)13-36-43(39,40)14-24(29,30)31/h3-8,12,36H,2,9-11,13-14H2,1H3,(H,37,38)/t22-/m0/s1 |
| InChIKey | IXDLDCHAHIGVMM-QFIPXVFZSA-N |
| XLogP | 5.02 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|