C26H24F9N3O4 — CID 139313524
3,3,3-trifluoro-N-[[(2S)-4-(5-methoxy-2-pyridinyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]methyl]propanamide (PubChem CID 139313524) has the molecular formula C26H24F9N3O4 and a molecular weight of 613.48 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[[(2S)-4-(5-methoxy-2-pyridinyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]methyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[[(2S)-4-(5-methoxy-2-pyridinyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]methyl]propanamide |
|---|---|
| PubChem CID | 139313524 |
| Molecular Formula | C26H24F9N3O4 |
| Molecular Weight | 613.48 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | 3,3,3-trifluoro-N-[[(2S)-4-(5-methoxy-2-pyridinyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]methyl]propanamide |
| SMILES | COc1ccc(C2=C(CNC(=O)CC(F)(F)F)C(=O)N[C@@](c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)C2)nc1 |
| InChI | InChI=1S/C26H24F9N3O4/c1-41-17-7-8-20(36-13-17)18-11-23(26(33,34)35,38-22(40)19(18)14-37-21(39)12-25(30,31)32)15-3-5-16(6-4-15)42-10-2-9-24(27,28)29/h3-8,13H,2,9-12,14H2,1H3,(H,37,39)(H,38,40)/t23-/m0/s1 |
| InChIKey | XKMRZLHLQWPXKQ-QHCPKHFHSA-N |
| XLogP | 5.61 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|