C26H26FN5O3 — CID 139313541
4-(8-ethyl-2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)-N-(2-methoxy-4-methyl-5-nitrophenyl)pyrimidin-2-amine (PubChem CID 139313541) has the molecular formula C26H26FN5O3 and a molecular weight of 475.52 g/mol. Its IUPAC name is 4-(8-ethyl-2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)-N-(2-methoxy-4-methyl-5-nitrophenyl)pyrimidin-2-amine.
| Compound Name | 4-(8-ethyl-2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)-N-(2-methoxy-4-methyl-5-nitrophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 139313541 |
| Molecular Formula | C26H26FN5O3 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 4-(8-ethyl-2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)-N-(2-methoxy-4-methyl-5-nitrophenyl)pyrimidin-2-amine |
| SMILES | CCC1CCn2c(c(-c3ccnc(Nc4cc([N+](=O)[O-])c(C)cc4OC)n3)c3cc(F)ccc32)C1 |
| InChI | InChI=1S/C26H26FN5O3/c1-4-16-8-10-31-21-6-5-17(27)13-18(21)25(23(31)12-16)19-7-9-28-26(29-19)30-20-14-22(32(33)34)15(2)11-24(20)35-3/h5-7,9,11,13-14,16H,4,8,10,12H2,1-3H3,(H,28,29,30) |
| InChIKey | RLNZRPAPRCTWCK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|